6,8,5'6'-Tetrahydroxy-3'-methylflavone
| Internal ID | fc8825e2-38d5-4da4-890e-2902191a6613 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
| IUPAC Name | 2-(2,3-dihydroxy-5-methylphenyl)-6,8-dihydroxychromen-4-one |
| SMILES (Canonical) | CC1=CC(=C(C(=C1)O)O)C2=CC(=O)C3=C(O2)C(=CC(=C3)O)O |
| SMILES (Isomeric) | CC1=CC(=C(C(=C1)O)O)C2=CC(=O)C3=C(O2)C(=CC(=C3)O)O |
| InChI | InChI=1S/C16H12O6/c1-7-2-10(15(21)12(19)3-7)14-6-11(18)9-4-8(17)5-13(20)16(9)22-14/h2-6,17,19-21H,1H3 |
| InChI Key | RKKNEAULDUVCCO-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.19% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.29% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.13% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.54% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.77% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.47% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.33% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.58% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.43% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 86.19% | 90.71% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.93% | 93.65% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.39% | 90.71% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.58% | 81.11% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 82.04% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.80% | 99.17% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 81.59% | 95.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.14% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71665587 |
| LOTUS | LTS0183899 |
| wikiData | Q75067724 |