(E)-3-[5-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2,4-dihydroxyphenyl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one
| Internal ID | feb4d807-4618-478d-b173-b18a0487e013 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | (E)-3-[5-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2,4-dihydroxyphenyl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
| SMILES (Canonical) | CC1=CC(C(C(C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C=C(C=C3)O)O)C4=C(C=C(C(=C4)C=CC(=O)C5=C(C=C(C=C5)O)O)O)O |
| SMILES (Isomeric) | CC1=C[C@H]([C@@H]([C@H](C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C=C(C=C3)O)O)C4=C(C=C(C(=C4)/C=C/C(=O)C5=C(C=C(C=C5)O)O)O)O |
| InChI | InChI=1S/C35H30O10/c1-17-10-26(22-6-3-19(36)13-30(22)41)34(35(45)24-8-5-21(38)15-32(24)43)27(11-17)25-12-18(29(40)16-33(25)44)2-9-28(39)23-7-4-20(37)14-31(23)42/h2-9,11-16,26-27,34,36-38,40-44H,10H2,1H3/b9-2+/t26-,27+,34-/m1/s1 |
| InChI Key | FVIDJVNMBFIWOX-TVWIHXPYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H30O10 |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.18389715 g/mol |
| Topological Polar Surface Area (TPSA) | 196.00 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
![2D Structure of (E)-3-[5-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2,4-dihydroxyphenyl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/683e75e0-8562-11ee-b326-e5a957cd42f0.jpg "2D Structure of (E)-3-[5-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-2,4-dihydroxyphenyl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.65% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.07% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.58% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.98% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.65% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.12% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.96% | 90.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.53% | 93.40% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.62% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.42% | 98.75% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 83.73% | 95.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.23% | 94.80% |
| CHEMBL3194 | P02766 | Transthyretin | 83.23% | 90.71% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.73% | 85.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.64% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.38% | 95.89% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.05% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Morus macroura |
| PubChem | 163008873 |
| LOTUS | LTS0121106 |
| wikiData | Q105002418 |