[(1S,2S,3S,4R,5R,7R,8R,9S,10S,13R,15S)-2-acetyloxy-4-formyl-13-(furan-3-yl)-5-hydroxy-9-(2-methoxy-2-oxoethyl)-4,8,10,12-tetramethyl-16-oxatetracyclo[8.6.0.03,8.011,15]hexadec-11-en-7-yl] (E)-2-methylbut-2-enoate
Internal ID | d4d4b6c7-56d2-49f7-b18d-2de5bf77f54e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(1S,2S,3S,4R,5R,7R,8R,9S,10S,13R,15S)-2-acetyloxy-4-formyl-13-(furan-3-yl)-5-hydroxy-9-(2-methoxy-2-oxoethyl)-4,8,10,12-tetramethyl-16-oxatetracyclo[8.6.0.03,8.011,15]hexadec-11-en-7-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C(C2C1(C(C3(C(C2OC(=O)C)OC4C3=C(C(C4)C5=COC=C5)C)C)CC(=O)OC)C)(C)C=O)O |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1C[C@H]([C@]([C@@H]2[C@]1([C@@H]([C@@]3([C@@H]([C@H]2OC(=O)C)O[C@@H]4C3=C([C@@H](C4)C5=COC=C5)C)C)CC(=O)OC)C)(C)C=O)O |
InChI | InChI=1S/C34H44O10/c1-9-17(2)31(39)44-25-14-24(37)32(5,16-35)29-28(42-19(4)36)30-34(7,23(33(25,29)6)13-26(38)40-8)27-18(3)21(12-22(27)43-30)20-10-11-41-15-20/h9-11,15-16,21-25,28-30,37H,12-14H2,1-8H3/b17-9+/t21-,22+,23+,24-,25-,28+,29-,30-,32+,33+,34+/m1/s1 |
InChI Key | JOVDKZRXWAATEG-XVDBJPKZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H44O10 |
Molecular Weight | 612.70 g/mol |
Exact Mass | 612.29344760 g/mol |
Topological Polar Surface Area (TPSA) | 139.00 Ų |
XlogP | 3.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.03% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.41% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.84% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.83% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.83% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.28% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.91% | 90.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.71% | 94.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 90.93% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.67% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.27% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.56% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.38% | 89.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.76% | 83.82% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.18% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.02% | 90.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.57% | 81.11% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 85.45% | 91.38% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.39% | 99.17% |
CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 84.77% | 90.48% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.54% | 93.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.49% | 97.50% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.60% | 87.67% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.09% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
Melia azedarach |
PubChem | 163030830 |
LOTUS | LTS0252229 |
wikiData | Q105132550 |