[18,21,22,24-Tetraacetyloxy-20-(acetyloxymethyl)-14,25-dihydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-9-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-19-yl] benzoate
Internal ID | 3ffe0baa-f031-47f2-8016-ec4bb027bc98 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [18,21,22,24-tetraacetyloxy-20-(acetyloxymethyl)-14,25-dihydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-9-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-19-yl] benzoate |
SMILES (Canonical) | CC1C2=C(C=NC=C2)C(=O)OCC3(C4C(C(C5(C(C(C(C(C5(C4OC(=O)C)O3)(C)O)OC(=O)C1(C)O)OC(=O)C)OC(=O)C6=CC=CC=C6)COC(=O)C)OC(=O)C)OC(=O)C)C |
SMILES (Isomeric) | CC1C2=C(C=NC=C2)C(=O)OCC3(C4C(C(C5(C(C(C(C(C5(C4OC(=O)C)O3)(C)O)OC(=O)C1(C)O)OC(=O)C)OC(=O)C6=CC=CC=C6)COC(=O)C)OC(=O)C)OC(=O)C)C |
InChI | InChI=1S/C43H49NO19/c1-20-27-15-16-44-17-28(27)37(51)56-18-39(7)29-30(57-22(3)46)34(60-25(6)49)42(19-55-21(2)45)35(61-36(50)26-13-11-10-12-14-26)31(58-23(4)47)33(62-38(52)40(20,8)53)41(9,54)43(42,63-39)32(29)59-24(5)48/h10-17,20,29-35,53-54H,18-19H2,1-9H3 |
InChI Key | XTKWHABDRIDBLJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H49NO19 |
Molecular Weight | 883.80 g/mol |
Exact Mass | 883.28987833 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.61% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.05% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.19% | 85.14% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 96.16% | 81.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.98% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.67% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.40% | 99.23% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.28% | 97.25% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.81% | 91.49% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 92.31% | 97.79% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.85% | 93.00% |
CHEMBL5028 | O14672 | ADAM10 | 88.83% | 97.50% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.71% | 89.44% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.34% | 91.07% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.03% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.26% | 83.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.97% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.62% | 95.56% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.43% | 94.62% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 82.98% | 87.67% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.68% | 82.69% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.43% | 89.34% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.54% | 91.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tripterygium wilfordii |
PubChem | 85263104 |
LOTUS | LTS0151432 |
wikiData | Q105341631 |