17-(5-Ethyl-3-hydroxy-6-methylheptan-2-yl)-3-hydroxy-4,10,13-trimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-6-one
Internal ID | 418652e6-0180-48ef-8dfe-4e8304b948cb |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | 17-(5-ethyl-3-hydroxy-6-methylheptan-2-yl)-3-hydroxy-4,10,13-trimethyl-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-6-one |
SMILES (Canonical) | CCC(CC(C(C)C1CCC2C1(CCC3C2=CC(=O)C4C3(CCC(C4C)O)C)C)O)C(C)C |
SMILES (Isomeric) | CCC(CC(C(C)C1CCC2C1(CCC3C2=CC(=O)C4C3(CCC(C4C)O)C)C)O)C(C)C |
InChI | InChI=1S/C30H50O3/c1-8-20(17(2)3)15-26(32)18(4)22-9-10-23-21-16-27(33)28-19(5)25(31)12-14-30(28,7)24(21)11-13-29(22,23)6/h16-20,22-26,28,31-32H,8-15H2,1-7H3 |
InChI Key | PFHQKGUFOAPKGD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H50O3 |
Molecular Weight | 458.70 g/mol |
Exact Mass | 458.37599545 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 7.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.78% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 98.58% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.10% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.71% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.93% | 90.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.79% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.29% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.26% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.59% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.08% | 95.93% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.37% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.68% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.75% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.85% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.58% | 86.33% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.55% | 94.78% |
CHEMBL1977 | P11473 | Vitamin D receptor | 83.32% | 99.43% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.73% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.37% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.84% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.55% | 90.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.02% | 93.03% |
CHEMBL268 | P43235 | Cathepsin K | 80.97% | 96.85% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum virginianum |
PubChem | 163042977 |
LOTUS | LTS0116384 |
wikiData | Q105207742 |