[(3S,5S,8S,9S,10S,12S,13S,14R,17S)-8,14,17-trihydroxy-17-[(1R)-1-hydroxyethyl]-3-[(2S,4R,5R,6S)-5-[(2R,4S,5R,6S)-5-[(2R,4R,5R,6R)-5-[(2R,3R,4R,5S,6R)-3-hydroxy-4-methoxy-6-methyl-5-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,5,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] pyridine-3-carboxylate
| Internal ID | 8d53b87e-8b9a-4ed8-a0b0-3061b6cd35f2 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | [(3S,5S,8S,9S,10S,12S,13S,14R,17S)-8,14,17-trihydroxy-17-[(1R)-1-hydroxyethyl]-3-[(2S,4R,5R,6S)-5-[(2R,4S,5R,6S)-5-[(2R,4R,5R,6R)-5-[(2R,3R,4R,5S,6R)-3-hydroxy-4-methoxy-6-methyl-5-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,5,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] pyridine-3-carboxylate |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2CCC3(C(C2)C=CC4(C3CC(C5(C4(CCC5(C(C)O)O)O)C)OC(=O)C6=CN=CC=C6)O)C)OC)OC7CC(C(C(O7)C)OC8CC(C(C(O8)C)OC9C(C(C(C(O9)C)OC1C(C(C(C(O1)CO)O)O)O)OC)O)OC)OC |
| SMILES (Isomeric) | C[C@H]1[C@H]([C@@H](C[C@H](O1)O[C@H]2CC[C@]3([C@@H](C2)C=C[C@@]4([C@H]3C[C@@H]([C@@]5([C@@]4(CC[C@]5([C@@H](C)O)O)O)C)OC(=O)C6=CN=CC=C6)O)C)OC)O[C@@H]7C[C@@H]([C@@H]([C@@H](O7)C)O[C@@H]8C[C@H]([C@@H]([C@H](O8)C)O[C@@H]9[C@@H]([C@H]([C@H]([C@H](O9)C)O[C@@H]1[C@H]([C@H]([C@H]([C@@H](O1)CO)O)O)O)OC)O)OC)OC |
| InChI | InChI=1S/C61H95NO25/c1-28-49(36(73-8)22-42(77-28)81-35-15-16-57(6)34(21-35)14-17-60(71)40(57)25-41(83-54(69)33-13-12-20-62-26-33)58(7)59(70,32(5)64)18-19-61(58,60)72)84-43-23-37(74-9)50(29(2)78-43)85-44-24-38(75-10)51(30(3)79-44)86-56-48(68)53(76-11)52(31(4)80-56)87-55-47(67)46(66)45(65)39(27-63)82-55/h12-14,17,20,26,28-32,34-53,55-56,63-68,70-72H,15-16,18-19,21-25,27H2,1-11H3/t28-,29-,30+,31+,32+,34+,35-,36+,37-,38+,39-,40-,41-,42+,43+,44+,45-,46-,47-,48+,49+,50+,51+,52-,53+,55+,56+,57-,58-,59+,60-,61+/m0/s1 |
| InChI Key | YJJCNFGPLJPACN-AGFODQLPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C61H95NO25 |
| Molecular Weight | 1242.40 g/mol |
| Exact Mass | 1241.61931752 g/mol |
| Topological Polar Surface Area (TPSA) | 351.00 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.70% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.81% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.66% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.65% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.27% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.08% | 96.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.10% | 97.36% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.99% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.78% | 95.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.43% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.28% | 99.23% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.25% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.34% | 89.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.52% | 98.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.51% | 100.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.30% | 95.17% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.63% | 100.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.56% | 91.24% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.54% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.20% | 94.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.01% | 95.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.55% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.43% | 90.00% |
| CHEMBL5028 | O14672 | ADAM10 | 85.29% | 97.50% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 85.20% | 97.53% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 84.22% | 88.42% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 83.95% | 89.92% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.85% | 98.46% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.83% | 92.62% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.76% | 91.07% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 82.58% | 91.43% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.71% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.50% | 94.45% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.81% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Marsdenia hainanensis |
| PubChem | 163106730 |
| LOTUS | LTS0062031 |
| wikiData | Q105349304 |