6,7-Dimethoxy-2-(4-methoxy-phenyl)-chromen-4-one
| Internal ID | 6e6d213c-7f0b-47c8-9254-35e8943add60 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | 6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC(=O)C3=CC(=C(C=C3O2)OC)OC |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=CC(=O)C3=CC(=C(C=C3O2)OC)OC |
| InChI | InChI=1S/C18H16O5/c1-20-12-6-4-11(5-7-12)15-9-14(19)13-8-17(21-2)18(22-3)10-16(13)23-15/h4-10H,1-3H3 |
| InChI Key | WUUSDSOPLLLGOF-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 54.00 Ų |
| XlogP | 3.50 |
| A1-02431 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.60% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 94.96% | 93.31% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.68% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.93% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.60% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.13% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.66% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.23% | 89.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.89% | 86.92% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.90% | 93.99% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.40% | 95.53% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.18% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.05% | 98.75% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.89% | 81.11% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.83% | 92.08% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.14% | 97.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.07% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gynerium sagittatum |
| PubChem | 12377628 |
| LOTUS | LTS0168272 |
| wikiData | Q105313324 |