(6,7-dimethoxy-1H-isochromen-3-yl)-(2,4-dimethoxyphenyl)methanone
| Internal ID | 8f63e9dc-adca-4c9a-b287-9a06cf559501 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Methoxybenzenes > Dimethoxybenzenes |
| IUPAC Name | (6,7-dimethoxy-1H-isochromen-3-yl)-(2,4-dimethoxyphenyl)methanone |
| SMILES (Canonical) | COC1=CC(=C(C=C1)C(=O)C2=CC3=CC(=C(C=C3CO2)OC)OC)OC |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)C(=O)C2=CC3=CC(=C(C=C3CO2)OC)OC)OC |
| InChI | InChI=1S/C20H20O6/c1-22-14-5-6-15(16(10-14)23-2)20(21)19-8-12-7-17(24-3)18(25-4)9-13(12)11-26-19/h5-10H,11H2,1-4H3 |
| InChI Key | QILGYKLDMADCHK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 63.20 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.63% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.72% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.17% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.05% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.83% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.96% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.38% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.30% | 99.17% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.61% | 81.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.93% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.48% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.43% | 92.62% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.99% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.77% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.46% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.24% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acacia carneorum |
| Goniorrhachis marginata |
| PubChem | 162962595 |
| LOTUS | LTS0136239 |
| wikiData | Q104195853 |