(6,7-dimethoxy-1H-isochromen-3-yl)-(2-hydroxy-4-methoxyphenyl)methanone
| Internal ID | acc3ad6b-e6d0-4ab1-b7ba-9620f2527a9a |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | (6,7-dimethoxy-1H-isochromen-3-yl)-(2-hydroxy-4-methoxyphenyl)methanone |
| SMILES (Canonical) | COC1=CC(=C(C=C1)C(=O)C2=CC3=CC(=C(C=C3CO2)OC)OC)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)C(=O)C2=CC3=CC(=C(C=C3CO2)OC)OC)O |
| InChI | InChI=1S/C19H18O6/c1-22-13-4-5-14(15(20)9-13)19(21)18-7-11-6-16(23-2)17(24-3)8-12(11)10-25-18/h4-9,20H,10H2,1-3H3 |
| InChI Key | QPHPZUZXUDCPEI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11033829 g/mol |
| Topological Polar Surface Area (TPSA) | 74.20 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.42% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.48% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.19% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.94% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.91% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.02% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.27% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.47% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.32% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.25% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.74% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.73% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.34% | 85.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.41% | 91.07% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.86% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.56% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.49% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Goniorrhachis marginata |
| PubChem | 15555866 |
| LOTUS | LTS0176546 |
| wikiData | Q104196059 |