(6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-methanol
| Internal ID | 164dde4b-9a17-402e-b8dc-3cbef6b6856b |
| Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
| IUPAC Name | (6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanol |
| SMILES (Canonical) | COC1=C(C=C2C(NCCC2=C1)CO)OC |
| SMILES (Isomeric) | COC1=C(C=C2C(NCCC2=C1)CO)OC |
| InChI | InChI=1S/C12H17NO3/c1-15-11-5-8-3-4-13-10(7-14)9(8)6-12(11)16-2/h5-6,10,13-14H,3-4,7H2,1-2H3 |
| InChI Key | JVLGDDNDVOSMSI-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12084340 g/mol |
| Topological Polar Surface Area (TPSA) | 50.70 Ų |
| XlogP | 0.60 |
| (6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-methanol |
| (6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanol |
| (+)-Calycotomine |
| CALYCOTOMINE,98 |
| SCHEMBL1817701 |
| DTXSID80345643 |
| MFCD07366618 |
| AB31032 |
| CS-0207203 |
| FT-0735604 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.21% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.61% | 92.94% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.27% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.69% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.71% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.97% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.11% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.72% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.64% | 97.25% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.46% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.18% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.97% | 98.95% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.68% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.26% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.38% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Genista anatolica |
| Genista burdurensis |
| PubChem | 606033 |
| LOTUS | LTS0132057 |
| wikiData | Q82118257 |