6,7-Dihydroxy-4a-methyl-3,8-dimethylidenedecahydroazuleno[6,5-b]furan-2(3h)-one
| Internal ID | 7c40f577-3747-4751-9568-f749fe374ef8 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | 6,7-dihydroxy-8a-methyl-1,5-dimethylidene-3a,4,5a,6,7,8,9,9a-octahydroazuleno[6,5-b]furan-2-one |
| SMILES (Canonical) | CC12CC3C(CC(=C)C1C(C(C2)O)O)OC(=O)C3=C |
| SMILES (Isomeric) | CC12CC3C(CC(=C)C1C(C(C2)O)O)OC(=O)C3=C |
| InChI | InChI=1S/C15H20O4/c1-7-4-11-9(8(2)14(18)19-11)5-15(3)6-10(16)13(17)12(7)15/h9-13,16-17H,1-2,4-6H2,3H3 |
| InChI Key | XWIOTWSCUBVKCL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 1.10 |
| 6,7-dihydroxy-4a-methyl-3,8-dimethylidenedecahydroazuleno[6,5-b]furan-2(3h)-one |
| NSC94033 |
| DTXSID40294082 |
| NSC-94033 |
| A845336 |
| 8a-methyl-1,5-dimethylidene-6,7-bis(oxidanyl)-3a,4,5a,6,7,8,9,9a-octahydroazuleno[6,5-b]furan-2-one |
![2D Structure of 6,7-Dihydroxy-4a-methyl-3,8-dimethylidenedecahydroazuleno[6,5-b]furan-2(3h)-one](https://plantaedb.com/storage/docs/compounds/2023/11/67-dihydroxy-4a-methyl-38-dimethylidenedecahydroazuleno65-bfuran-23h-one.jpg "2D Structure of 6,7-Dihydroxy-4a-methyl-3,8-dimethylidenedecahydroazuleno[6,5-b]furan-2(3h)-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.17% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.48% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.40% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.13% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.35% | 95.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.46% | 93.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.07% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.54% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.59% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.73% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.31% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gaillardia pulchella |
| PubChem | 261575 |
| LOTUS | LTS0149366 |
| wikiData | Q82033157 |