6,7-Dihydroxy-3-isocyanochromen-2-one
| Internal ID | 7d5b0253-408a-444b-b53c-f6e3c91bda2e |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Hydroxycoumarins > 6,7-dihydroxycoumarins |
| IUPAC Name | 6,7-dihydroxy-3-isocyanochromen-2-one |
| SMILES (Canonical) | [C-]#[N+]C1=CC2=CC(=C(C=C2OC1=O)O)O |
| SMILES (Isomeric) | [C-]#[N+]C1=CC2=CC(=C(C=C2OC1=O)O)O |
| InChI | InChI=1S/C10H5NO4/c1-11-6-2-5-3-7(12)8(13)4-9(5)15-10(6)14/h2-4,12-13H |
| InChI Key | PBXVYKHISUQHKY-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H5NO4 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.02185764 g/mol |
| Topological Polar Surface Area (TPSA) | 71.10 Ų |
| XlogP | 1.10 |
| 6,7-dihydroxy-3-isocyanochromen-2-one |
| CHEBI:140649 |
| 6,7-dihydroxy-3-isocyano-2H-chromen-2-one |
| 6,7-dihydroxy-3-isocyano-2H-1-benzopyran-2-one |
| 957062-50-9 |
| RefChem:169588 |
| C22449 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.85% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.39% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.25% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.90% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.87% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.33% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.20% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.91% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.85% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 130034774 |
| LOTUS | LTS0237940 |
| wikiData | Q104194255 |