6,6,9a-Trimethyl-4,5,5a,7,8,9-hexahydrobenzo[g]benzofuran
| Internal ID | 54eff234-6aa4-48c7-8749-ad00cfc48ee1 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydrobenzo[g][1]benzofuran |
| SMILES (Canonical) | CC1(CCCC2(C1CCC3=C2OC=C3)C)C |
| SMILES (Isomeric) | CC1(CCCC2(C1CCC3=C2OC=C3)C)C |
| InChI | InChI=1S/C15H22O/c1-14(2)8-4-9-15(3)12(14)6-5-11-7-10-16-13(11)15/h7,10,12H,4-6,8-9H2,1-3H3 |
| InChI Key | UWERXMNLYPEUNC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.167065321 g/mol |
| Topological Polar Surface Area (TPSA) | 13.10 Ų |
| XlogP | 4.90 |
| NSC622267 |
| 6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydrobenzo[g]benzofuran |
| 6,6,9a-Trimethyl-4,5,5a,6,7,8,9,9a-octahydronaphtho[1,2-b]furan |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.27% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.00% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.43% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.28% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.00% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.42% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.39% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.57% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.45% | 94.45% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.05% | 93.04% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.58% | 92.94% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.52% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.81% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 494404 |
| LOTUS | LTS0218573 |
| wikiData | Q105280309 |