methyl (1S,4S,5R,6S,7R,8S,10R,14R,15S,16R,18S,19R,22R,23R,25S,26S)-23-acetyloxy-7,14-dihydroxy-4-methoxy-6,16,22-trimethyl-25-[(E)-3-phenylprop-2-enoyl]oxy-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4-carboxylate
Internal ID | e93053b1-552e-444b-9139-a3cc716828b7 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | methyl (1S,4S,5R,6S,7R,8S,10R,14R,15S,16R,18S,19R,22R,23R,25S,26S)-23-acetyloxy-7,14-dihydroxy-4-methoxy-6,16,22-trimethyl-25-[(E)-3-phenylprop-2-enoyl]oxy-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4-carboxylate |
SMILES (Canonical) | CC(=O)OC1CC(C23COC(C2C4(C(C5C3C1(CO5)C)OC6(C4(C7CC6C8(C=COC8O7)O)O)C)C)(C(=O)OC)OC)OC(=O)C=CC9=CC=CC=C9 |
SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@@H]([C@]23CO[C@@]([C@H]2[C@]4([C@@H]([C@H]5[C@H]3[C@@]1(CO5)C)O[C@]6([C@@]4([C@@H]7C[C@H]6[C@@]8(C=CO[C@@H]8O7)O)O)C)C)(C(=O)OC)OC)OC(=O)/C=C/C9=CC=CC=C9 |
InChI | InChI=1S/C39H46O14/c1-20(40)50-23-17-24(51-26(41)13-12-21-10-8-7-9-11-21)36-19-49-38(46-6,31(42)45-5)30(36)34(3)29(27-28(36)33(23,2)18-48-27)53-35(4)22-16-25(39(34,35)44)52-32-37(22,43)14-15-47-32/h7-15,22-25,27-30,32,43-44H,16-19H2,1-6H3/b13-12+/t22-,23-,24+,25+,27-,28+,29-,30+,32-,33-,34-,35-,36+,37-,38+,39+/m1/s1 |
InChI Key | DXADLTAZYMMMNI-CEDYRYFSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H46O14 |
Molecular Weight | 738.80 g/mol |
Exact Mass | 738.28875614 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
![2D Structure of methyl (1S,4S,5R,6S,7R,8S,10R,14R,15S,16R,18S,19R,22R,23R,25S,26S)-23-acetyloxy-7,14-dihydroxy-4-methoxy-6,16,22-trimethyl-25-[(E)-3-phenylprop-2-enoyl]oxy-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4-carboxylate 2D Structure of methyl (1S,4S,5R,6S,7R,8S,10R,14R,15S,16R,18S,19R,22R,23R,25S,26S)-23-acetyloxy-7,14-dihydroxy-4-methoxy-6,16,22-trimethyl-25-[(E)-3-phenylprop-2-enoyl]oxy-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/663f4860-84fc-11ee-92c4-b5c6d1e844c7.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.93% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.67% | 86.33% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 96.24% | 94.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.04% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.22% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.98% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 90.97% | 97.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.70% | 91.19% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.18% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.01% | 85.14% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.86% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.22% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.88% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.67% | 94.45% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.06% | 94.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.05% | 92.62% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.82% | 97.28% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.27% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.69% | 95.50% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.41% | 89.67% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.10% | 93.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.62% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 163079602 |
LOTUS | LTS0122708 |
wikiData | Q104990881 |