(4,10-Dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 3-methylbutanoate
Internal ID | 86ff9c2c-e133-4d8b-9366-092158f632ad |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
IUPAC Name | (4,10-dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 3-methylbutanoate |
SMILES (Canonical) | CC1CCCC(C(C2C(C(C1=O)O)C(=C)C(=O)O2)OC(=O)CC(C)C)(C)O |
SMILES (Isomeric) | CC1CCCC(C(C2C(C(C1=O)O)C(=C)C(=O)O2)OC(=O)CC(C)C)(C)O |
InChI | InChI=1S/C20H30O7/c1-10(2)9-13(21)26-18-17-14(12(4)19(24)27-17)16(23)15(22)11(3)7-6-8-20(18,5)25/h10-11,14,16-18,23,25H,4,6-9H2,1-3,5H3 |
InChI Key | YDDBYAHYJZNEBN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O7 |
Molecular Weight | 382.40 g/mol |
Exact Mass | 382.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.93% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.33% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.83% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.80% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.16% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.79% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.51% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 87.31% | 98.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 86.75% | 83.57% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.42% | 97.09% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.08% | 96.47% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.91% | 91.07% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.69% | 93.03% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.83% | 97.79% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.66% | 85.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.13% | 91.19% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.02% | 100.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.97% | 95.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.28% | 100.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.07% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dittrichia viscosa |
PubChem | 162968622 |
LOTUS | LTS0075866 |
wikiData | Q105346673 |