6'',6''-Dimethylpyrano[2'',3'':6',5']-2'-hydroxy-4,4'-dimethoxychalcone
| Internal ID | fec082c8-64f1-45b4-97fe-48a9bbb6504f |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
| IUPAC Name | (E)-1-(7-hydroxy-5-methoxy-2,2-dimethylchromen-8-yl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES (Canonical) | CC1(C=CC2=C(C=C(C(=C2O1)C(=O)C=CC3=CC=C(C=C3)OC)O)OC)C |
| SMILES (Isomeric) | CC1(C=CC2=C(C=C(C(=C2O1)C(=O)/C=C/C3=CC=C(C=C3)OC)O)OC)C |
| InChI | InChI=1S/C22H22O5/c1-22(2)12-11-16-19(26-4)13-18(24)20(21(16)27-22)17(23)10-7-14-5-8-15(25-3)9-6-14/h5-13,24H,1-4H3/b10-7+ |
| InChI Key | VETSXWXDHHAXNB-JXMROGBWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 4.80 |
| LMPK12120310 |
![2D Structure of 6'',6''-Dimethylpyrano[2'',3'':6',5']-2'-hydroxy-4,4'-dimethoxychalcone](https://plantaedb.com/storage/docs/compounds/2023/11/66-dimethylpyrano2365-2-hydroxy-44-dimethoxychalcone.jpg "2D Structure of 6'',6''-Dimethylpyrano[2'',3'':6',5']-2'-hydroxy-4,4'-dimethoxychalcone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.73% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 95.05% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.70% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.49% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.39% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.33% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.77% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.75% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 89.72% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.55% | 95.50% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.46% | 93.99% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.28% | 91.07% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.82% | 99.15% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.92% | 85.14% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 81.83% | 92.86% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.52% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.38% | 94.73% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.83% | 85.30% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.20% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pleiotaxis rugosa |
| PubChem | 12017381 |
| LOTUS | LTS0089609 |
| wikiData | Q105187472 |