(6,6-Dimethyl-9-methylidene-10-oxo-2-tricyclo[5.4.0.02,8]undecanyl)methyl acetate
| Internal ID | ef94736c-3cc5-46c3-b31e-96fbf9ba81d0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | (6,6-dimethyl-9-methylidene-10-oxo-2-tricyclo[5.4.0.02,8]undecanyl)methyl acetate |
| SMILES (Canonical) | CC(=O)OCC12CCCC(C3C1CC(=O)C(=C)C23)(C)C |
| SMILES (Isomeric) | CC(=O)OCC12CCCC(C3C1CC(=O)C(=C)C23)(C)C |
| InChI | InChI=1S/C17H24O3/c1-10-13(19)8-12-15-14(10)17(12,9-20-11(2)18)7-5-6-16(15,3)4/h12,14-15H,1,5-9H2,2-4H3 |
| InChI Key | KTMFYMFFCCKGCP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.17254462 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
![2D Structure of (6,6-Dimethyl-9-methylidene-10-oxo-2-tricyclo[5.4.0.02,8]undecanyl)methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/66-dimethyl-9-methylidene-10-oxo-2-tricyclo540028undecanylmethyl-acetate.jpg "2D Structure of (6,6-Dimethyl-9-methylidene-10-oxo-2-tricyclo[5.4.0.02,8]undecanyl)methyl acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.92% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.28% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.73% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.27% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.65% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.92% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.59% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.89% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.19% | 91.19% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.80% | 82.69% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.69% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.42% | 97.09% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.02% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Marsupella aquatica |
| Marsupella emarginata |
| PubChem | 101676205 |
| LOTUS | LTS0085366 |
| wikiData | Q104402382 |