6(5H)-Phenanthridinone, 9-methyl-
| Internal ID | 35883734-0e30-485e-95e1-bda563ef227c |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Phenanthridines and derivatives |
| IUPAC Name | 9-methyl-5H-phenanthridin-6-one |
| SMILES (Canonical) | CC1=CC2=C(C=C1)C(=O)NC3=CC=CC=C32 |
| SMILES (Isomeric) | CC1=CC2=C(C=C1)C(=O)NC3=CC=CC=C32 |
| InChI | InChI=1S/C14H11NO/c1-9-6-7-11-12(8-9)10-4-2-3-5-13(10)15-14(11)16/h2-8H,1H3,(H,15,16) |
| InChI Key | RNKGUYMQALAAEY-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.084063974 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 2.80 |
| 107622-37-7 |
| DTXSID90467244 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.64% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.73% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.97% | 98.95% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.90% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.97% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.10% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.97% | 99.23% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.98% | 94.80% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.95% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.63% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.57% | 93.99% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.55% | 91.71% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 80.11% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis cyanocarpa |
| PubChem | 11481210 |
| LOTUS | LTS0127612 |
| wikiData | Q82294065 |