(1S,7aS,11aS)-4-(hydroxymethyl)-8,8,11a-trimethyl-1,5-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-6,7,7a,9,10,11-hexahydro-1H-naphtho[1,2-e][2]benzofuran-3-one
| Internal ID | 54a7932a-051d-44a7-9c44-876e6f5e7eb5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | (1S,7aS,11aS)-4-(hydroxymethyl)-8,8,11a-trimethyl-1,5-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-6,7,7a,9,10,11-hexahydro-1H-naphtho[1,2-e][2]benzofuran-3-one |
| SMILES (Canonical) | CC1(CCCC2(C1CCC3=C2C4=C(C(=C3OC5C(C(C(C(O5)CO)O)O)O)CO)C(=O)OC4OC6C(C(C(C(O6)CO)O)O)O)C)C |
| SMILES (Isomeric) | C[C@]12CCCC([C@@H]1CCC3=C2C4=C(C(=C3O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)CO)C(=O)O[C@@H]4O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)(C)C |
| InChI | InChI=1S/C32H46O15/c1-31(2)7-4-8-32(3)16(31)6-5-12-19(32)18-17(13(9-33)26(12)45-29-24(40)22(38)20(36)14(10-34)43-29)27(42)46-28(18)47-30-25(41)23(39)21(37)15(11-35)44-30/h14-16,20-25,28-30,33-41H,4-11H2,1-3H3/t14-,15-,16+,20-,21-,22+,23+,24-,25-,28-,29+,30+,32+/m1/s1 |
| InChI Key | WAUGJPPEYHQYOR-VHLCKXKSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H46O15 |
| Molecular Weight | 670.70 g/mol |
| Exact Mass | 670.28367076 g/mol |
| Topological Polar Surface Area (TPSA) | 245.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.98% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.39% | 98.95% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 95.59% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.14% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.60% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.06% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.21% | 96.38% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.17% | 86.92% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 89.63% | 98.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.49% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.42% | 95.93% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.38% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.31% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.57% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.79% | 94.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.77% | 86.33% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 86.69% | 95.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.67% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.95% | 99.23% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.36% | 90.08% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.62% | 94.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.44% | 97.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.48% | 92.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.39% | 93.99% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.03% | 92.50% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.99% | 96.21% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.86% | 96.77% |
| CHEMBL4072 | P07858 | Cathepsin B | 80.39% | 93.67% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.05% | 96.09% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.03% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Betonica officinalis |
| PubChem | 10628234 |
| LOTUS | LTS0181917 |
| wikiData | Q105300476 |