methyl (2S,3S,4S,5R,6R)-6-[[(1R,2S,4S,5S,8R,10S,14R,15R,18S,20R)-1,2,8,15,19,19-hexamethyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-18-hexacyclo[12.8.0.02,11.04,8.05,10.015,20]docos-11-enyl]oxy]-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylate
Internal ID | 8256089a-f3eb-4abe-801b-4657f871ad5d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (2S,3S,4S,5R,6R)-6-[[(1R,2S,4S,5S,8R,10S,14R,15R,18S,20R)-1,2,8,15,19,19-hexamethyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-18-hexacyclo[12.8.0.02,11.04,8.05,10.015,20]docos-11-enyl]oxy]-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylate |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(C(O4)C(=O)OC)O)O)OC5C(C(C(CO5)O)O)O)C)CC=C6C3(CC7C8(CCC7(C6C8)C(=O)OC9C(C(C(C(O9)CO)O)O)O)C)C)C)C |
SMILES (Isomeric) | C[C@]12CC[C@@]3([C@H]1C[C@@]4(C(=CC[C@H]5[C@]4(CC[C@@H]6[C@@]5(CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(=O)OC)O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)C)C)[C@@H]3C2)C)C(=O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O |
InChI | InChI=1S/C47H72O18/c1-42(2)24-10-13-45(5)25(44(24,4)12-11-27(42)62-40-36(32(54)31(53)35(63-40)37(57)59-7)64-38-33(55)28(50)22(49)19-60-38)9-8-20-21-16-43(3)14-15-47(21,26(43)17-46(20,45)6)41(58)65-39-34(56)30(52)29(51)23(18-48)61-39/h8,21-36,38-40,48-56H,9-19H2,1-7H3/t21-,22+,23+,24-,25+,26-,27-,28-,29+,30-,31-,32-,33+,34+,35-,36+,38-,39-,40+,43+,44-,45+,46+,47+/m0/s1 |
InChI Key | RMFWYMLKYCMXPZ-JAVKWJGGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H72O18 |
Molecular Weight | 925.10 g/mol |
Exact Mass | 924.47186544 g/mol |
Topological Polar Surface Area (TPSA) | 281.00 Ų |
XlogP | 2.30 |
There are no found synonyms. |
![2D Structure of methyl (2S,3S,4S,5R,6R)-6-[[(1R,2S,4S,5S,8R,10S,14R,15R,18S,20R)-1,2,8,15,19,19-hexamethyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-18-hexacyclo[12.8.0.02,11.04,8.05,10.015,20]docos-11-enyl]oxy]-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylate 2D Structure of methyl (2S,3S,4S,5R,6R)-6-[[(1R,2S,4S,5S,8R,10S,14R,15R,18S,20R)-1,2,8,15,19,19-hexamethyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-18-hexacyclo[12.8.0.02,11.04,8.05,10.015,20]docos-11-enyl]oxy]-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/65ab8c00-85c0-11ee-94e8-573022bab82a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.66% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.30% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.38% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.89% | 97.09% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.32% | 94.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.84% | 94.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.97% | 96.77% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.28% | 90.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.10% | 92.62% |
CHEMBL2581 | P07339 | Cathepsin D | 84.64% | 98.95% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.82% | 91.24% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.73% | 92.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.49% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.31% | 95.56% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.99% | 95.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.74% | 97.25% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.67% | 91.07% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.29% | 95.83% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.28% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.26% | 97.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.09% | 96.61% |
CHEMBL5028 | O14672 | ADAM10 | 80.04% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hebanthe eriantha |
PubChem | 163053299 |
LOTUS | LTS0192862 |
wikiData | Q105240749 |