[6-[4-[5,7-Dihydroxy-4-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-yl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate
Internal ID | 89cee6ab-a615-4185-9880-04814be90a0e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [6-[4-[5,7-dihydroxy-4-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-yl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C=CC(=O)OCC2C(C(C(C(O2)OC3=CC=C(C=C3)C4=C(C(=O)C5=C(C=C(C=C5O4)O)O)OC6C(C(C(C(O6)CO)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C=CC(=O)OCC2C(C(C(C(O2)OC3=CC=C(C=C3)C4=C(C(=O)C5=C(C=C(C=C5O4)O)O)OC6C(C(C(C(O6)CO)O)O)O)O)O)O |
InChI | InChI=1S/C38H40O20/c1-51-21-9-15(10-22(52-2)27(21)43)3-8-25(42)53-14-24-29(45)32(48)33(49)37(57-24)54-18-6-4-16(5-7-18)35-36(30(46)26-19(41)11-17(40)12-20(26)55-35)58-38-34(50)31(47)28(44)23(13-39)56-38/h3-12,23-24,28-29,31-34,37-41,43-45,47-50H,13-14H2,1-2H3 |
InChI Key | JJCBHWCCKRCSAM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H40O20 |
Molecular Weight | 816.70 g/mol |
Exact Mass | 816.21129366 g/mol |
Topological Polar Surface Area (TPSA) | 310.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.72% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.77% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.63% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.46% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.48% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 93.94% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.73% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.43% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.20% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.53% | 97.09% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.82% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.74% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.83% | 86.92% |
CHEMBL220 | P22303 | Acetylcholinesterase | 85.99% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.99% | 99.15% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.02% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.08% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.57% | 90.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.48% | 94.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.08% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.75% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.04% | 92.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.32% | 99.23% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.26% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brassica napus |
PubChem | 162882815 |
LOTUS | LTS0170009 |
wikiData | Q105129542 |