(4aS,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-9-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-sulfooxyoxan-2-yl]oxycarbonyl-2,2,6a,6b,9,12a-hexamethyl-10-sulfooxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
| Internal ID | cdcf9fe5-3e73-4c3a-8afb-25ae1b5a87e3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | (4aS,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-9-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-sulfooxyoxan-2-yl]oxycarbonyl-2,2,6a,6b,9,12a-hexamethyl-10-sulfooxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C(=O)OC6C(C(C(C(O6)CO)OS(=O)(=O)O)O)O)OS(=O)(=O)O)C)C)C2C1)C)C(=O)O)C |
| SMILES (Isomeric) | C[C@]12CC[C@@H]([C@@]([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)C)C)(C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)OS(=O)(=O)O)O)O)OS(=O)(=O)O |
| InChI | InChI=1S/C36H56O16S2/c1-31(2)13-15-36(29(40)41)16-14-33(4)19(20(36)17-31)7-8-22-32(3)11-10-24(51-53(43,44)45)35(6,23(32)9-12-34(22,33)5)30(42)50-28-26(39)25(38)27(21(18-37)49-28)52-54(46,47)48/h7,20-28,37-39H,8-18H2,1-6H3,(H,40,41)(H,43,44,45)(H,46,47,48)/t20-,21+,22+,23+,24-,25+,26+,27+,28-,32+,33+,34+,35-,36-/m0/s1 |
| InChI Key | RMYFCGTYNZAFBT-MVRINBNTSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C36H56O16S2 |
| Molecular Weight | 809.00 g/mol |
| Exact Mass | 808.30097804 g/mol |
| Topological Polar Surface Area (TPSA) | 278.00 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.09% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.22% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.22% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.98% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.38% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.90% | 96.77% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.76% | 92.50% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.19% | 95.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.16% | 100.00% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.76% | 97.33% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.33% | 95.83% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.55% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.73% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.01% | 89.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.98% | 94.33% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.89% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eremogone juncea |
| PubChem | 162903529 |
| LOTUS | LTS0190688 |
| wikiData | Q105241146 |