methyl (3S)-3-acetyloxy-3-[(1R,2S,3R,5R,6R,7R,8S,10S,11S,14S)-3,8-diacetyloxy-11-(furan-3-yl)-5-(2-hydroxypropan-2-yl)-2,6,10-trimethyl-13-oxo-12,15-dioxatetracyclo[8.5.0.01,14.02,7]pentadecan-6-yl]propanoate
Internal ID | 3e877f63-a8de-48d2-9248-1a73107cb297 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
IUPAC Name | methyl (3S)-3-acetyloxy-3-[(1R,2S,3R,5R,6R,7R,8S,10S,11S,14S)-3,8-diacetyloxy-11-(furan-3-yl)-5-(2-hydroxypropan-2-yl)-2,6,10-trimethyl-13-oxo-12,15-dioxatetracyclo[8.5.0.01,14.02,7]pentadecan-6-yl]propanoate |
SMILES (Canonical) | CC(=O)OC1CC(C(C2C1(C34C(O3)C(=O)OC(C4(CC2OC(=O)C)C)C5=COC=C5)C)(C)C(CC(=O)OC)OC(=O)C)C(C)(C)O |
SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@H]([C@]([C@@H]2[C@@]1([C@]34[C@H](O3)C(=O)O[C@H]([C@@]4(C[C@@H]2OC(=O)C)C)C5=COC=C5)C)(C)[C@H](CC(=O)OC)OC(=O)C)C(C)(C)O |
InChI | InChI=1S/C33H44O13/c1-16(34)42-20-14-30(6)26(19-10-11-41-15-19)45-28(38)27-33(30,46-27)32(8)23(44-18(3)36)12-21(29(4,5)39)31(7,25(20)32)22(43-17(2)35)13-24(37)40-9/h10-11,15,20-23,25-27,39H,12-14H2,1-9H3/t20-,21-,22-,23+,25+,26-,27+,30-,31+,32+,33+/m0/s1 |
InChI Key | RSIYXEAXVGYFPE-WOEAOWLDSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C33H44O13 |
Molecular Weight | 648.70 g/mol |
Exact Mass | 648.27819145 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.40% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.20% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.07% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.68% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.66% | 83.82% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.02% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.22% | 89.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 89.05% | 95.71% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.99% | 97.79% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 88.60% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.91% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.58% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.10% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.92% | 97.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.38% | 94.73% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.60% | 92.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.31% | 91.19% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.25% | 92.62% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.54% | 91.07% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.23% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.05% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrela odorata |
PubChem | 24882560 |
LOTUS | LTS0212290 |
wikiData | Q105244697 |