[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[[(1S,2R,3R)-7-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxan-2-yl]methyl 4-hydroxy-3-methoxybenzoate
| Internal ID | 7f8315bf-afeb-496b-a9e7-b23a7e1b3e5e |
| Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
| IUPAC Name | [(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[[(1S,2R,3R)-7-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxan-2-yl]methyl 4-hydroxy-3-methoxybenzoate |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C(C(CC3=CC(=C(C(=C23)OC)O)OC)CO)COC4C(C(C(C(O4)COC(=O)C5=CC(=C(C=C5)O)OC)O)O)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)[C@@H]2[C@H]([C@@H](CC3=CC(=C(C(=C23)OC)O)OC)CO)CO[C@@H]4[C@H]([C@@H]([C@H]([C@@H](O4)COC(=O)C5=CC(=C(C=C5)O)OC)O)O)O |
| InChI | InChI=1S/C36H44O16/c1-45-22-9-16(6-7-21(22)38)35(44)50-15-26-30(40)32(42)33(43)36(52-26)51-14-20-19(13-37)8-17-10-25(48-4)31(41)34(49-5)28(17)27(20)18-11-23(46-2)29(39)24(12-18)47-3/h6-7,9-12,19-20,26-27,30,32-33,36-43H,8,13-15H2,1-5H3/t19-,20-,26-,27+,30-,32+,33-,36-/m0/s1 |
| InChI Key | LVQMXTVSQMYOHE-IWLFCDFXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H44O16 |
| Molecular Weight | 732.70 g/mol |
| Exact Mass | 732.26293531 g/mol |
| Topological Polar Surface Area (TPSA) | 233.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.54% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.58% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.52% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.50% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.77% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.67% | 89.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.31% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.88% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.45% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.25% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 86.92% | 90.71% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.42% | 92.62% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.29% | 96.61% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.08% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.01% | 92.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.95% | 94.73% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.31% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.12% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.46% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.18% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lysidice brevicalyx |
| PubChem | 162842501 |
| LOTUS | LTS0095503 |
| wikiData | Q105157991 |