(1S,2R,3R,9R,10S,17S)-2-(3,5-dihydroxyphenyl)-3,9,17-tris(4-hydroxyphenyl)-8-oxapentacyclo[8.7.2.04,18.07,19.011,16]nonadeca-4(18),5,7(19),11(16),12,14-hexaene-5,13,15-triol
Internal ID | ed62b648-b09f-4f5c-8792-17ba3e8d0c9d |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (1S,2R,3R,9R,10S,17S)-2-(3,5-dihydroxyphenyl)-3,9,17-tris(4-hydroxyphenyl)-8-oxapentacyclo[8.7.2.04,18.07,19.011,16]nonadeca-4(18),5,7(19),11(16),12,14-hexaene-5,13,15-triol |
SMILES (Canonical) | C1=CC(=CC=C1C2C(C3C(C4=C(C=C(C=C4O)O)C5C(OC6=C5C3=C2C(=C6)O)C7=CC=C(C=C7)O)C8=CC=C(C=C8)O)C9=CC(=CC(=C9)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1[C@H]2[C@@H]([C@H]3[C@H](C4=C(C=C(C=C4O)O)[C@@H]5[C@@H](OC6=C5C3=C2C(=C6)O)C7=CC=C(C=C7)O)C8=CC=C(C=C8)O)C9=CC(=CC(=C9)O)O)O |
InChI | InChI=1S/C42H32O9/c43-23-7-1-19(2-8-23)33-35(22-13-26(46)15-27(47)14-22)40-34(20-3-9-24(44)10-4-20)36-29(16-28(48)17-30(36)49)37-39-32(18-31(50)38(33)41(39)40)51-42(37)21-5-11-25(45)12-6-21/h1-18,33-35,37,40,42-50H/t33-,34-,35-,37-,40+,42-/m0/s1 |
InChI Key | QDEHKEFWCRAFDN-JDBYBMEESA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H32O9 |
Molecular Weight | 680.70 g/mol |
Exact Mass | 680.20463259 g/mol |
Topological Polar Surface Area (TPSA) | 171.00 Ų |
XlogP | 6.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.71% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.37% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.31% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.92% | 99.15% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.82% | 93.40% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.51% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 83.77% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.03% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 80.85% | 90.71% |
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 80.71% | 91.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitis vinifera |
PubChem | 131636775 |
LOTUS | LTS0174791 |
wikiData | Q105218772 |