(1S,2R,4aS,6aS,6bR,10S,11S,12aR)-11-hydroxy-10-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid
Internal ID | 927255fa-56fa-4b93-b540-ac8172e0d13e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2R,4aS,6aS,6bR,10S,11S,12aR)-11-hydroxy-10-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)OC(=O)C=CC6=CC=C(C=C6)O)O)C)C)C2C1C)C)C(=O)O |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]([C@H](C5(C)C)OC(=O)/C=C/C6=CC=C(C=C6)O)O)C)C)C2[C@H]1C)C)C(=O)O |
InChI | InChI=1S/C39H54O6/c1-23-16-19-39(34(43)44)21-20-37(6)27(32(39)24(23)2)13-14-30-36(5)22-28(41)33(35(3,4)29(36)17-18-38(30,37)7)45-31(42)15-10-25-8-11-26(40)12-9-25/h8-13,15,23-24,28-30,32-33,40-41H,14,16-22H2,1-7H3,(H,43,44)/b15-10+/t23-,24+,28+,29?,30?,32?,33-,36+,37-,38-,39+/m1/s1 |
InChI Key | FEVUQLLYZLSRLB-ABHSXMDCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H54O6 |
Molecular Weight | 618.80 g/mol |
Exact Mass | 618.39203944 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 8.70 |
There are no found synonyms. |
![2D Structure of (1S,2R,4aS,6aS,6bR,10S,11S,12aR)-11-hydroxy-10-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid 2D Structure of (1S,2R,4aS,6aS,6bR,10S,11S,12aR)-11-hydroxy-10-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/645d5200-8557-11ee-99d9-ab9b051a0cce.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.53% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.49% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.58% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.85% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.77% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.10% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 89.20% | 98.95% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.67% | 91.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.68% | 91.19% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.54% | 93.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.95% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.90% | 100.00% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 84.55% | 97.64% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.43% | 91.07% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.99% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.03% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.24% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Styrax camporum |
PubChem | 163015347 |
LOTUS | LTS0023564 |
wikiData | Q104994229 |