(2R,3S)-3-[(12R,19R,26E,29S)-5-[4-[(3-amino-3-oxoprop-1-en-2-yl)carbamoyl]-1,3-thiazol-2-yl]-4-hydroxy-29-[(1S)-1-hydroxyethyl]-12-(hydroxymethyl)-26-(1-methoxyethylidene)-14,21,28,31-tetraoxo-10,17,24,34-tetrathia-6,13,20,27,30,35,36,37,38-nonazahexacyclo[30.2.1.18,11.115,18.122,25.02,7]octatriaconta-1(35),2,4,6,8,11(38),15,18(37),22,25(36),32-undecaen-19-yl]-2,3-dihydroxypropanoic acid
| Internal ID | 24aa4a54-6294-4230-a127-22e330c06ce5 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
| IUPAC Name | (2R,3S)-3-[(12R,19R,26E,29S)-5-[4-[(3-amino-3-oxoprop-1-en-2-yl)carbamoyl]-1,3-thiazol-2-yl]-4-hydroxy-29-[(1S)-1-hydroxyethyl]-12-(hydroxymethyl)-26-(1-methoxyethylidene)-14,21,28,31-tetraoxo-10,17,24,34-tetrathia-6,13,20,27,30,35,36,37,38-nonazahexacyclo[30.2.1.18,11.115,18.122,25.02,7]octatriaconta-1(35),2,4,6,8,11(38),15,18(37),22,25(36),32-undecaen-19-yl]-2,3-dihydroxypropanoic acid |
| SMILES (Canonical) | CC(C1C(=O)NC(=C(C)OC)C2=NC(=CS2)C(=O)NC(C3=NC(=CS3)C(=O)NC(C4=NC(=CS4)C5=NC(=C(C=C5C6=NC(=CS6)C(=O)N1)O)C7=NC(=CS7)C(=O)NC(=C)C(=O)N)CO)C(C(C(=O)O)O)O)O |
| SMILES (Isomeric) | C[C@@H]([C@H]1C(=O)N/C(=C(\C)/OC)/C2=NC(=CS2)C(=O)N[C@@H](C3=NC(=CS3)C(=O)N[C@@H](C4=NC(=CS4)C5=NC(=C(C=C5C6=NC(=CS6)C(=O)N1)O)C7=NC(=CS7)C(=O)NC(=C)C(=O)N)CO)[C@@H]([C@H](C(=O)O)O)O)O |
| InChI | InChI=1S/C41H38N12O14S5/c1-12(30(42)59)43-31(60)18-9-71-39(48-18)26-22(56)5-15-25(50-26)17-7-69-37(45-17)16(6-54)44-32(61)19-10-72-40(49-19)27(28(57)29(58)41(65)66)53-34(63)21-11-70-38(47-21)24(14(3)67-4)52-35(64)23(13(2)55)51-33(62)20-8-68-36(15)46-20/h5,7-11,13,16,23,27-29,54-58H,1,6H2,2-4H3,(H2,42,59)(H,43,60)(H,44,61)(H,51,62)(H,52,64)(H,53,63)(H,65,66)/b24-14+/t13-,16+,23-,27+,28-,29+/m0/s1 |
| InChI Key | ORMJUQMAZVTCKY-VFUHOBBSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H38N12O14S5 |
| Molecular Weight | 1083.10 g/mol |
| Exact Mass | 1082.12339980 g/mol |
| Topological Polar Surface Area (TPSA) | 555.00 Ų |
| XlogP | -0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.11% | 96.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 98.60% | 93.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.29% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.08% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.65% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.18% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.00% | 99.15% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.42% | 89.63% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.78% | 94.75% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 92.11% | 80.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.31% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.30% | 99.23% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 90.40% | 97.53% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.63% | 96.90% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.56% | 95.17% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 88.50% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.14% | 91.19% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.83% | 90.71% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.49% | 96.38% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.26% | 95.50% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.77% | 91.24% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 83.97% | 92.29% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.21% | 90.20% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.07% | 91.07% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.91% | 86.33% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.76% | 96.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.73% | 99.17% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 82.51% | 94.97% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.51% | 92.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.27% | 95.56% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.08% | 95.64% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.15% | 98.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162865891 |
| LOTUS | LTS0055449 |
| wikiData | Q105198044 |