[(1S,3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-1-hydroxyethyl]-3-[(2R,3R,4R,5R,6R)-3-hydroxy-6-(hydroxymethyl)-4,5-bis[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy]oxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate
Internal ID | f267c5ea-ba1f-4f58-b8e1-c098d3ef27a2 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives > Withanolide glycosides and derivatives |
IUPAC Name | [(1S,3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R)-4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-1-hydroxyethyl]-3-[(2R,3R,4R,5R,6R)-3-hydroxy-6-(hydroxymethyl)-4,5-bis[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy]oxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC=C5C4(C(CC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(CO7)O)O)O)OC8C(C(C(CO8)O)O)O)O)OC(=O)C)C)C)O)C |
SMILES (Isomeric) | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@H]2CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4([C@H](C[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)OC(=O)C)C)C)O)C |
InChI | InChI=1S/C46H70O19/c1-19-13-32(63-40(56)20(19)2)46(6,57)30-10-9-25-24-8-7-22-14-23(15-31(60-21(3)48)45(22,5)26(24)11-12-44(25,30)4)61-43-37(55)39(65-42-36(54)34(52)28(50)18-59-42)38(29(16-47)62-43)64-41-35(53)33(51)27(49)17-58-41/h7,23-39,41-43,47,49-55,57H,8-18H2,1-6H3/t23-,24+,25+,26+,27-,28-,29-,30+,31+,32-,33+,34+,35-,36-,37-,38-,39-,41+,42+,43-,44+,45+,46-/m1/s1 |
InChI Key | QHMSSLJMTUALEC-WCYVVETNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H70O19 |
Molecular Weight | 927.00 g/mol |
Exact Mass | 926.45113000 g/mol |
Topological Polar Surface Area (TPSA) | 290.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.25% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.40% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.86% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.21% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.01% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.85% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.93% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.33% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.89% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.71% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.24% | 94.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.42% | 90.08% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.13% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.07% | 97.14% |
CHEMBL5028 | O14672 | ADAM10 | 85.81% | 97.50% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 85.73% | 95.92% |
CHEMBL2581 | P07339 | Cathepsin D | 85.20% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.04% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.81% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.70% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.62% | 99.23% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.86% | 85.83% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.80% | 95.93% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.75% | 91.07% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.52% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.08% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.70% | 95.89% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.58% | 100.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.93% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eriolarynx australis |
PubChem | 101625608 |
LOTUS | LTS0127618 |
wikiData | Q105221030 |