6,4'-Dihydroxy-7-methoxyflavan
| Internal ID | 73e66038-183f-4dae-beef-2bee05814aee |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | (2S)-2-(4-hydroxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-6-ol |
| SMILES (Canonical) | COC1=C(C=C2CCC(OC2=C1)C3=CC=C(C=C3)O)O |
| SMILES (Isomeric) | COC1=C(C=C2CC[C@H](OC2=C1)C3=CC=C(C=C3)O)O |
| InChI | InChI=1S/C16H16O4/c1-19-16-9-15-11(8-13(16)18)4-7-14(20-15)10-2-5-12(17)6-3-10/h2-3,5-6,8-9,14,17-18H,4,7H2,1H3/t14-/m0/s1 |
| InChI Key | RHHDYYWXCOHKMQ-AWEZNQCLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.10 |
| AKOS040762686 |
| 202463-50-1 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.08% | 96.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.18% | 91.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.60% | 97.09% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.36% | 95.78% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.05% | 92.94% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 91.65% | 88.48% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.72% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.90% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.76% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.51% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.55% | 94.00% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 86.43% | 82.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.58% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.39% | 99.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.20% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.00% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.26% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.14% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 80.64% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dalbergia cochinchinensis |
| Dalbergia odorifera |
| PubChem | 25181513 |
| LOTUS | LTS0173011 |
| wikiData | Q105236367 |