(4aR,10aR)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid
Internal ID | 960223e8-b156-47f9-a8fd-5740490e49f2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (4aR,10aR)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
SMILES (Canonical) | CC(C)C1=C(C(=C2C(=C1)CCC3C2(CCCC3(C)C)C(=O)O)O)O |
SMILES (Isomeric) | CC(C)C1=C(C(=C2C(=C1)CC[C@H]3[C@@]2(CCCC3(C)C)C(=O)O)O)O |
InChI | InChI=1S/C20H28O4/c1-11(2)13-10-12-6-7-14-19(3,4)8-5-9-20(14,18(23)24)15(12)17(22)16(13)21/h10-11,14,21-22H,5-9H2,1-4H3,(H,23,24)/t14-,20-/m1/s1 |
InChI Key | QRYRORQUOLYVBU-JLTOFOAXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O4 |
Molecular Weight | 332.40 g/mol |
Exact Mass | 332.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 4.90 |
There are no found synonyms. |
![2D Structure of (4aR,10aR)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid 2D Structure of (4aR,10aR)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/63dbc1f0-853a-11ee-a902-23902f850c00.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.89% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.49% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 94.40% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.48% | 96.09% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.05% | 97.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.84% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.96% | 97.25% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.23% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.99% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.61% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.41% | 99.15% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.71% | 96.38% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.34% | 93.03% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.13% | 91.07% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.91% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.49% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.79% | 99.23% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.37% | 93.04% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.01% | 100.00% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 80.80% | 95.71% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.54% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rosmarinus officinalis |
Salvia willeana |
PubChem | 36689575 |
LOTUS | LTS0069249 |
wikiData | Q105226750 |