[3-Formyl-2-(hydroxymethyl)-4-(3-oxoprop-1-en-2-yl)cyclopent-2-en-1-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 62d72578-40cc-453e-9803-303b53a72fca |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
IUPAC Name | [3-formyl-2-(hydroxymethyl)-4-(3-oxoprop-1-en-2-yl)cyclopent-2-en-1-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C=C(C=O)C1CC(C(=C1C=O)CO)OC(=O)C=CC2=CC=C(C=C2)O |
SMILES (Isomeric) | C=C(C=O)C1CC(C(=C1C=O)CO)OC(=O)C=CC2=CC=C(C=C2)O |
InChI | InChI=1S/C19H18O6/c1-12(9-20)15-8-18(17(11-22)16(15)10-21)25-19(24)7-4-13-2-5-14(23)6-3-13/h2-7,9-10,15,18,22-23H,1,8,11H2 |
InChI Key | IOKUHHOVWITKLG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H18O6 |
Molecular Weight | 342.30 g/mol |
Exact Mass | 342.11033829 g/mol |
Topological Polar Surface Area (TPSA) | 101.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
![2D Structure of [3-Formyl-2-(hydroxymethyl)-4-(3-oxoprop-1-en-2-yl)cyclopent-2-en-1-yl] 3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [3-Formyl-2-(hydroxymethyl)-4-(3-oxoprop-1-en-2-yl)cyclopent-2-en-1-yl] 3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/63bcec60-84b9-11ee-8bda-a5a98bd53b2b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.17% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.19% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.04% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.83% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.58% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.38% | 94.45% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 86.06% | 97.64% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.86% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.60% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.54% | 91.49% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.43% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.38% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 84.25% | 90.71% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.78% | 89.67% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.66% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.64% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.05% | 89.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.47% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viburnum luzonicum |
PubChem | 85037358 |
LOTUS | LTS0056838 |
wikiData | Q105116728 |