(2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-2-[[(1S,2R,5R,7S,10R,11R,14R,15S,16S,18R,20S)-16-hydroxy-2,6,6,10,16-pentamethyl-18-(2-methylprop-1-enyl)-19,21-dioxahexacyclo[18.2.1.01,14.02,11.05,10.015,20]tricosan-7-yl]oxy]oxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | 8c546fcd-a82f-45cd-8785-14289ce4edab |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-2-[[(1S,2R,5R,7S,10R,11R,14R,15S,16S,18R,20S)-16-hydroxy-2,6,6,10,16-pentamethyl-18-(2-methylprop-1-enyl)-19,21-dioxahexacyclo[18.2.1.01,14.02,11.05,10.015,20]tricosan-7-yl]oxy]oxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC(=CC1CC(C2C3CCC4C5(CCC(C(C5CCC4(C36CC2(O1)OC6)C)(C)C)OC7C(C(C(CO7)O)OC8C(C(C(C(O8)COC9C(C(C(C(O9)CO)O)O)O)O)O)O)OC1C(C(C(O1)CO)O)O)C)(C)O)C |
| SMILES (Isomeric) | CC(=C[C@H]1C[C@]([C@@H]2[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@]36C[C@@]2(O1)OC6)C)(C)C)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H](O1)CO)O)O)C)(C)O)C |
| InChI | InChI=1S/C52H84O22/c1-22(2)14-23-15-50(7,64)42-24-8-9-30-48(5)12-11-31(47(3,4)29(48)10-13-49(30,6)51(24)20-52(42,74-23)67-21-51)71-46-41(73-44-37(61)33(57)27(17-54)69-44)40(25(55)18-65-46)72-45-39(63)36(60)34(58)28(70-45)19-66-43-38(62)35(59)32(56)26(16-53)68-43/h14,23-46,53-64H,8-13,15-21H2,1-7H3/t23-,24+,25-,26+,27-,28+,29-,30+,31-,32+,33-,34+,35-,36-,37+,38+,39+,40-,41+,42-,43+,44-,45-,46-,48-,49+,50-,51-,52-/m0/s1 |
| InChI Key | ZHWPUQMDCMHHBR-CCKICRFUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C52H84O22 |
| Molecular Weight | 1061.20 g/mol |
| Exact Mass | 1060.54542430 g/mol |
| Topological Polar Surface Area (TPSA) | 335.00 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.13% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.76% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.35% | 95.93% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 96.07% | 95.92% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.34% | 96.61% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.02% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.64% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.87% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.70% | 95.50% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 90.00% | 89.05% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.89% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.44% | 90.17% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.85% | 91.24% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.22% | 100.00% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 88.19% | 100.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.00% | 97.28% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.78% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.42% | 95.89% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 86.31% | 97.47% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.19% | 92.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.92% | 97.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.94% | 89.00% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 84.71% | 97.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.62% | 98.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.21% | 92.94% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 83.37% | 92.97% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.98% | 82.69% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.84% | 95.38% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.28% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.22% | 96.95% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.92% | 92.50% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 81.10% | 95.36% |
| CHEMBL2094128 | P24941 | Cyclin-dependent kinase 2/cyclin A | 81.07% | 97.25% |
| CHEMBL3589 | P55263 | Adenosine kinase | 80.83% | 98.05% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.48% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Elissarrhena longipes |
| PubChem | 21574211 |
| LOTUS | LTS0122494 |
| wikiData | Q105376066 |