(3S)-5-hydroxy-3-[(4-methoxyphenyl)methyl]-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one
| Internal ID | 28eb519e-9aa2-443d-88df-c6ce67e8943d |
| Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
| IUPAC Name | (3S)-5-hydroxy-3-[(4-methoxyphenyl)methyl]-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OCC(C4=O)CC5=CC=C(C=C5)OC)O)O)O)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC[C@@H](C4=O)CC5=CC=C(C=C5)OC)O)O)O)O)O)O)O |
| InChI | InChI=1S/C29H36O14/c1-12-21(31)24(34)26(36)28(41-12)40-11-19-23(33)25(35)27(37)29(43-19)42-16-8-17(30)20-18(9-16)39-10-14(22(20)32)7-13-3-5-15(38-2)6-4-13/h3-6,8-9,12,14,19,21,23-31,33-37H,7,10-11H2,1-2H3/t12-,14-,19+,21-,23+,24+,25-,26+,27+,28+,29+/m0/s1 |
| InChI Key | MNAJRLRTCXSJDZ-BHOIVYCBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H36O14 |
| Molecular Weight | 608.60 g/mol |
| Exact Mass | 608.21050582 g/mol |
| Topological Polar Surface Area (TPSA) | 214.00 Ų |
| XlogP | -0.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.77% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.04% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.33% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.46% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.92% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.81% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.31% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.65% | 95.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.07% | 94.80% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.06% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.07% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.82% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.59% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.47% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.78% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.53% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.30% | 92.62% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.17% | 85.31% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 83.59% | 96.69% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.30% | 97.36% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 83.19% | 97.78% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.57% | 95.93% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.13% | 95.53% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.12% | 93.40% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.79% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ledebouria floribunda |
| PubChem | 163055697 |
| LOTUS | LTS0201161 |
| wikiData | Q105168226 |