(E)-3-(4-hydroxyphenyl)-1-[2-hydroxy-6-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl]prop-2-en-1-one
Internal ID | 332b1dae-3608-4354-9f6b-13e0b4f16843 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | (E)-3-(4-hydroxyphenyl)-1-[2-hydroxy-6-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl]prop-2-en-1-one |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)C2=C(C=C(C=C2OC3C(C(C(C(O3)CO)O)O)O)OC4C(C(C(C(O4)COC5C(C(C(C(O5)CO)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)C2=C(C=C(C=C2O[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@H]([C@@H]([C@H]([C@@H](O5)CO)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C33H42O20/c34-9-18-22(39)25(42)28(45)31(51-18)48-11-20-24(41)27(44)29(46)32(53-20)49-14-7-16(38)21(15(37)6-3-12-1-4-13(36)5-2-12)17(8-14)50-33-30(47)26(43)23(40)19(10-35)52-33/h1-8,18-20,22-36,38-47H,9-11H2/b6-3+/t18-,19-,20+,22-,23-,24+,25+,26+,27-,28-,29+,30-,31-,32+,33-/m0/s1 |
InChI Key | VTFGBUPKGZVIHW-ODBPMKMBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H42O20 |
Molecular Weight | 758.70 g/mol |
Exact Mass | 758.22694372 g/mol |
Topological Polar Surface Area (TPSA) | 335.00 Ų |
XlogP | -2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 96.32% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.18% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.84% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.53% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.49% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.54% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.18% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.88% | 94.73% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.65% | 91.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.63% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.46% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.37% | 90.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.17% | 89.67% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.51% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.39% | 86.92% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.52% | 95.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.12% | 99.15% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.05% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asarum canadense |
PubChem | 163185808 |
LOTUS | LTS0084720 |
wikiData | Q105292701 |