[15-[1-(4,5-Dimethyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-6,15-dihydroxy-2,16-dimethyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-14-yl] acetate
Internal ID | f2ebb2ed-9900-44e4-b653-0fd63b8ab0df |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | [15-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-6,15-dihydroxy-2,16-dimethyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-14-yl] acetate |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)C2(C(CC3C2(CCC4C3CC5C6(C4(C(=O)C=CC6O)C)O5)C)OC(=O)C)O)C |
SMILES (Isomeric) | CC1=C(C(=O)OC(C1)C(C)C2(C(CC3C2(CCC4C3CC5C6(C4(C(=O)C=CC6O)C)O5)C)OC(=O)C)O)C |
InChI | InChI=1S/C30H40O8/c1-14-11-21(37-26(34)15(14)2)16(3)29(35)24(36-17(4)31)13-20-18-12-25-30(38-25)23(33)8-7-22(32)28(30,6)19(18)9-10-27(20,29)5/h7-8,16,18-21,23-25,33,35H,9-13H2,1-6H3 |
InChI Key | LIICUVJIVOHKOY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H40O8 |
Molecular Weight | 528.60 g/mol |
Exact Mass | 528.27231823 g/mol |
Topological Polar Surface Area (TPSA) | 123.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.65% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.73% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.52% | 97.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.32% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.18% | 82.69% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.17% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.29% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.17% | 94.45% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.93% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 87.98% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.97% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.68% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.86% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.50% | 89.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.41% | 93.56% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 85.00% | 95.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.09% | 93.04% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.84% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.66% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.91% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.79% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.71% | 93.03% |
CHEMBL5028 | O14672 | ADAM10 | 80.69% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Athenaea fasciculata |
PubChem | 162846978 |
LOTUS | LTS0118183 |
wikiData | Q105152191 |