3-hydroxy-3-[3-[5-hydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-(2-methylprop-1-enyl)oxolan-2-one
Internal ID | 47442299-411f-45a1-a3a6-4c449013f016 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 3-hydroxy-3-[3-[5-hydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-(2-methylprop-1-enyl)oxolan-2-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CCC4(C5CCC6C(CCC6(C5(CCC4C3(C)C)C)C)C7(CC(OC7=O)C=C(C)C)O)C)CO)O)OC8C(C(C(CO8)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CCC4(C5CCC6C(CCC6(C5(CCC4C3(C)C)C)C)C7(CC(OC7=O)C=C(C)C)O)C)CO)O)OC8C(C(C(CO8)O)O)O)O)O)O |
InChI | InChI=1S/C47H76O17/c1-21(2)17-23-18-47(57,42(56)60-23)25-11-15-45(7)24(25)9-10-29-44(6)14-13-30(43(4,5)28(44)12-16-46(29,45)8)62-41-38(64-40-36(55)34(53)31(50)22(3)59-40)37(33(52)27(19-48)61-41)63-39-35(54)32(51)26(49)20-58-39/h17,22-41,48-55,57H,9-16,18-20H2,1-8H3 |
InChI Key | FYSVMXWLJSUANI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H76O17 |
Molecular Weight | 913.10 g/mol |
Exact Mass | 912.50825095 g/mol |
Topological Polar Surface Area (TPSA) | 264.00 Ų |
XlogP | 3.20 |
There are no found synonyms. |
![2D Structure of 3-hydroxy-3-[3-[5-hydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-(2-methylprop-1-enyl)oxolan-2-one 2D Structure of 3-hydroxy-3-[3-[5-hydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-(2-methylprop-1-enyl)oxolan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/6298bcc0-857e-11ee-b449-c3ed3c507b67.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.13% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.29% | 94.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.89% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.28% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.08% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.54% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.29% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.08% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.70% | 96.61% |
CHEMBL2581 | P07339 | Cathepsin D | 89.39% | 98.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.00% | 97.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.84% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.62% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.78% | 97.25% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.84% | 96.77% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.53% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.32% | 97.14% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.38% | 95.93% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.85% | 93.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.32% | 90.08% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.24% | 92.88% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.23% | 92.94% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.20% | 100.00% |
CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 81.87% | 92.86% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.87% | 91.24% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.73% | 95.92% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.22% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gynostemma pentaphyllum |
PubChem | 72750231 |
LOTUS | LTS0082937 |
wikiData | Q105004696 |