[(3S,8R,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | cb937eef-fe0f-4149-a21c-2638b2f19c9a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
IUPAC Name | [(3S,8R,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(C)C(C)CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C=CC5=CC(=C(C=C5)O)OC)C)C |
SMILES (Isomeric) | C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@@H]2CC=C4[C@@]3(CC[C@@H](C4)OC(=O)C=CC5=CC(=C(C=C5)O)OC)C)C |
InChI | InChI=1S/C38H56O4/c1-24(2)25(3)8-9-26(4)31-14-15-32-30-13-12-28-23-29(18-20-37(28,5)33(30)19-21-38(31,32)6)42-36(40)17-11-27-10-16-34(39)35(22-27)41-7/h10-12,16-17,22,24-26,29-33,39H,8-9,13-15,18-21,23H2,1-7H3/t25-,26-,29+,30-,31-,32+,33+,37+,38-/m1/s1 |
InChI Key | SWIWTAJTJOYCTB-SOAWAIIASA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H56O4 |
Molecular Weight | 576.80 g/mol |
Exact Mass | 576.41786026 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 11.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.30% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.14% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.34% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.25% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.22% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.84% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.70% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.59% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.76% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 90.51% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.87% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.71% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.41% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.93% | 91.07% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.12% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.74% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.68% | 92.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.56% | 94.08% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.65% | 91.03% |
CHEMBL240 | Q12809 | HERG | 84.83% | 89.76% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.98% | 89.50% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.50% | 93.99% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.49% | 99.15% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.57% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.46% | 91.19% |
CHEMBL5028 | O14672 | ADAM10 | 81.31% | 97.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.30% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Oryza sativa |
PubChem | 121232959 |
LOTUS | LTS0267432 |
wikiData | Q104391698 |