(1R,6R,13R)-10,13-dihydroxy-16,17-dimethoxy-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-one
Internal ID | 9c934e3e-daf9-4519-8150-5d57b946a3e6 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Rotenoids > Rotenones |
IUPAC Name | (1R,6R,13R)-10,13-dihydroxy-16,17-dimethoxy-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-12-one |
SMILES (Canonical) | CC(=C)C1CC2=C(O1)C=C(C3=C2OC4COC5=CC(=C(C=C5C4(C3=O)O)OC)OC)O |
SMILES (Isomeric) | CC(=C)[C@H]1CC2=C(O1)C=C(C3=C2O[C@@H]4COC5=CC(=C(C=C5[C@@]4(C3=O)O)OC)OC)O |
InChI | InChI=1S/C23H22O8/c1-10(2)14-5-11-15(30-14)7-13(24)20-21(11)31-19-9-29-16-8-18(28-4)17(27-3)6-12(16)23(19,26)22(20)25/h6-8,14,19,24,26H,1,5,9H2,2-4H3/t14-,19-,23-/m1/s1 |
InChI Key | JCJPVNDLAAXNEX-WNHYQHMGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H22O8 |
Molecular Weight | 426.40 g/mol |
Exact Mass | 426.13146766 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 3.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.31% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.91% | 83.82% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.70% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.49% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.26% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.66% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.65% | 93.40% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.57% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.59% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 90.23% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.27% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.02% | 86.33% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.21% | 94.80% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.25% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.51% | 90.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.30% | 91.49% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.73% | 97.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.56% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 85.36% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.26% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.27% | 99.23% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.59% | 92.62% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 83.19% | 95.62% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.20% | 89.50% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.87% | 82.67% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.48% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tephrosia villosa |
Tephrosia viridiflora |
PubChem | 51537291 |
LOTUS | LTS0222147 |
wikiData | Q105124868 |