[(2S,4R,5R,5aS,6S,8S,9aS,10S,10aS)-2,5,6,8-tetraacetyloxy-10-benzoyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-oxo-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-4-yl] benzoate
| Internal ID | b7ed51ba-921b-4ea2-9dc7-f58165e3b1b1 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
| IUPAC Name | [(2S,4R,5R,5aS,6S,8S,9aS,10S,10aS)-2,5,6,8-tetraacetyloxy-10-benzoyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-oxo-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-4-yl] benzoate |
| SMILES (Canonical) | CC1=C2C(C(C3(C(CC(C(=O)C3C(C2(CC1OC(=O)C)C(C)(C)O)OC(=O)C4=CC=CC=C4)OC(=O)C)OC(=O)C)C)OC(=O)C)OC(=O)C5=CC=CC=C5 |
| SMILES (Isomeric) | CC1=C2[C@H]([C@@H]([C@@]3([C@H](C[C@@H](C(=O)[C@@H]3[C@@H]([C@@]2(C[C@@H]1OC(=O)C)C(C)(C)O)OC(=O)C4=CC=CC=C4)OC(=O)C)OC(=O)C)C)OC(=O)C)OC(=O)C5=CC=CC=C5 |
| InChI | InChI=1S/C41H46O14/c1-21-29(51-23(3)43)20-41(39(6,7)49)31(21)34(54-37(47)26-15-11-9-12-16-26)36(53-25(5)45)40(8)30(52-24(4)44)19-28(50-22(2)42)33(46)32(40)35(41)55-38(48)27-17-13-10-14-18-27/h9-18,28-30,32,34-36,49H,19-20H2,1-8H3/t28-,29-,30-,32+,34+,35-,36-,40+,41-/m0/s1 |
| InChI Key | YKZZDRVIKKOWBI-XREQEZOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H46O14 |
| Molecular Weight | 762.80 g/mol |
| Exact Mass | 762.28875614 g/mol |
| Topological Polar Surface Area (TPSA) | 195.00 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.41% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.49% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.21% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.12% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.66% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.76% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.70% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.62% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.31% | 98.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.11% | 82.69% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.06% | 94.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.47% | 99.23% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.37% | 81.11% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 85.40% | 92.97% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.72% | 93.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.52% | 89.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.82% | 90.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.25% | 97.14% |
| CHEMBL5028 | O14672 | ADAM10 | 81.87% | 97.50% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.34% | 83.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.22% | 85.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.69% | 91.07% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.62% | 91.19% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.30% | 87.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taxus brevifolia |
| PubChem | 163028586 |
| LOTUS | LTS0135802 |
| wikiData | Q105349995 |