(1S,3R,6S,8R,11S,12S,15R,16R)-15-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol
Internal ID | f5746db4-4f65-42c1-ae19-8337b713b33c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | (1S,3R,6S,8R,11S,12S,15R,16R)-15-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
SMILES (Canonical) | CC(C)C(CCC(C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C)O |
SMILES (Isomeric) | C[C@H](CC[C@H](C(C)C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O)C)C |
InChI | InChI=1S/C30H52O2/c1-19(2)22(31)9-8-20(3)21-12-14-28(7)24-11-10-23-26(4,5)25(32)13-15-29(23)18-30(24,29)17-16-27(21,28)6/h19-25,31-32H,8-18H2,1-7H3/t20-,21-,22-,23+,24+,25+,27-,28+,29-,30+/m1/s1 |
InChI Key | ICBBJGYDHALMGM-BBEZHFTESA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H52O2 |
Molecular Weight | 444.70 g/mol |
Exact Mass | 444.396730897 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 8.70 |
There are no found synonyms. |
![2D Structure of (1S,3R,6S,8R,11S,12S,15R,16R)-15-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol 2D Structure of (1S,3R,6S,8R,11S,12S,15R,16R)-15-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol](https://plantaedb.com/storage/docs/compounds/2023/11/618ed4d0-8690-11ee-b36e-596946024b0f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.65% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.91% | 96.09% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.61% | 95.58% |
CHEMBL2581 | P07339 | Cathepsin D | 92.44% | 98.95% |
CHEMBL240 | Q12809 | HERG | 90.99% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.81% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.38% | 97.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.99% | 92.86% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.04% | 94.45% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.89% | 97.93% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.29% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.23% | 96.47% |
CHEMBL3837 | P07711 | Cathepsin L | 83.14% | 96.61% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 83.06% | 97.64% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.94% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.93% | 100.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.69% | 98.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.62% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.15% | 93.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.93% | 90.24% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.27% | 90.17% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.99% | 94.78% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.67% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juncus effusus |
PubChem | 162952519 |
LOTUS | LTS0083209 |
wikiData | Q105110879 |