[(2S,6R)-8-[(1R,4aS,7S,7aS)-7-hydroxy-7-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbonyl]oxy-2,6-dimethyloctyl] (1S,4aS,6R,7aS)-6-hydroxy-7-methylidene-1-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate
| Internal ID | 8fc332a5-76aa-49a6-8ca7-cebad3540cb2 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
| IUPAC Name | [(2S,6R)-8-[(1R,4aS,7S,7aS)-7-hydroxy-7-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbonyl]oxy-2,6-dimethyloctyl] (1S,4aS,6R,7aS)-6-hydroxy-7-methylidene-1-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
| SMILES (Canonical) | CC(CCCC(C)COC(=O)C1=COC(C2C1CC(C2=C)O)OC3C(C(C(C(O3)CO)O)O)O)CCOC(=O)C4=COC(C5C4CCC5(C)O)OC6C(C(C(C(O6)CO)O)O)O |
| SMILES (Isomeric) | C[C@H](CCC[C@H](C)COC(=O)C1=CO[C@H]([C@H]2[C@@H]1C[C@H](C2=C)O)O[C@H]3[C@@H]([C@@H]([C@@H]([C@@H](O3)CO)O)O)O)CCOC(=O)C4=CO[C@@H]([C@H]5[C@@H]4CC[C@]5(C)O)O[C@@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O)O |
| InChI | InChI=1S/C42H64O20/c1-18(9-11-55-36(52)23-16-58-39(29-21(23)8-10-42(29,4)54)62-41-35(51)33(49)31(47)27(14-44)60-41)6-5-7-19(2)15-56-37(53)24-17-57-38(28-20(3)25(45)12-22(24)28)61-40-34(50)32(48)30(46)26(13-43)59-40/h16-19,21-22,25-35,38-41,43-51,54H,3,5-15H2,1-2,4H3/t18-,19+,21-,22-,25-,26+,27-,28-,29-,30-,31+,32-,33+,34-,35-,38+,39-,40+,41-,42+/m1/s1 |
| InChI Key | ACZFDOMPWNLLHA-OHTDZOQNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C42H64O20 |
| Molecular Weight | 888.90 g/mol |
| Exact Mass | 888.39909443 g/mol |
| Topological Polar Surface Area (TPSA) | 310.00 Ų |
| XlogP | -0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.61% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.67% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.22% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.37% | 97.09% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 93.56% | 94.45% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.16% | 96.61% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.69% | 96.21% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.12% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.89% | 95.89% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.66% | 97.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.51% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.11% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.86% | 90.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.94% | 89.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.74% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.11% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.81% | 92.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.72% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.36% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.63% | 96.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.39% | 91.19% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.96% | 92.94% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.78% | 96.90% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.50% | 91.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.43% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.21% | 86.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.16% | 100.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.03% | 92.88% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.97% | 94.97% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.46% | 93.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.42% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Premna odorata |
| PubChem | 162912823 |
| LOTUS | LTS0130223 |
| wikiData | Q104909424 |