6,11-oxido-Acor-4-ene
Internal ID | d3f5c467-c233-4fa1-bc36-ccd8c3fae558 |
Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
IUPAC Name | (1R,3aR,5aR,9aS)-1,4,4,7-tetramethyl-2,3,3a,5a,8,9-hexahydro-1H-cyclopenta[c][1]benzofuran |
SMILES (Canonical) | CC1CCC2C13CCC(=CC3OC2(C)C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@@H]2[C@]13CCC(=C[C@H]3OC2(C)C)C |
InChI | InChI=1S/C15H24O/c1-10-7-8-15-11(2)5-6-12(15)14(3,4)16-13(15)9-10/h9,11-13H,5-8H2,1-4H3/t11-,12+,13-,15+/m1/s1 |
InChI Key | JGKMDLIITSKWAD-COMQUAJESA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24O |
Molecular Weight | 220.35 g/mol |
Exact Mass | 220.182715385 g/mol |
Topological Polar Surface Area (TPSA) | 9.20 Ų |
XlogP | 3.30 |
JGKMDLIITSKWAD-COMQUAJESA-N |
DTXSID101316968 |
104188-25-2 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.19% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.73% | 97.25% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 87.10% | 86.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.93% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.05% | 96.61% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.45% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.23% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.90% | 95.56% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.33% | 95.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.92% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.45% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cupressus bakeri |
PubChem | 91747164 |
LOTUS | LTS0175018 |
wikiData | Q105127481 |