[(1R,2R,5S,6S,9R,11S,14R,15S,18R,19R,20R)-20-(2-ethyl-3-methylbutyl)-6-methyl-23-oxo-21,22-dioxahexacyclo[17.2.2.02,15.02,18.05,14.06,11]tricosan-9-yl] acetate
| Internal ID | f026e735-7aef-48cf-85e3-e28b314b506c |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
| IUPAC Name | [(1R,2R,5S,6S,9R,11S,14R,15S,18R,19R,20R)-20-(2-ethyl-3-methylbutyl)-6-methyl-23-oxo-21,22-dioxahexacyclo[17.2.2.02,15.02,18.05,14.06,11]tricosan-9-yl] acetate |
| SMILES (Canonical) | CCC(CC1C2C3CCC4C3(CCC5C4CCC6C5(CCC(C6)OC(=O)C)C)C(O1)OC2=O)C(C)C |
| SMILES (Isomeric) | CCC(C[C@@H]1[C@H]2[C@H]3CC[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@H](C6)OC(=O)C)C)[C@H](O1)OC2=O)C(C)C |
| InChI | InChI=1S/C31H48O5/c1-6-19(17(2)3)15-26-27-25-10-9-24-22-8-7-20-16-21(34-18(4)32)11-13-30(20,5)23(22)12-14-31(24,25)29(35-26)36-28(27)33/h17,19-27,29H,6-16H2,1-5H3/t19?,20-,21+,22+,23-,24-,25+,26+,27+,29+,30-,31+/m0/s1 |
| InChI Key | BXTFLLHVJAONOL-KXCYLCNDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.70 g/mol |
| Exact Mass | 500.35017463 g/mol |
| Topological Polar Surface Area (TPSA) | 61.80 Ų |
| XlogP | 8.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.05% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.73% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.78% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.13% | 91.11% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.06% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.24% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.78% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.30% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.10% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.88% | 98.95% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.88% | 95.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.08% | 89.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.93% | 89.50% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.93% | 94.66% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.88% | 82.69% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.32% | 97.14% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.13% | 98.10% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.96% | 96.95% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.02% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.80% | 92.62% |
| CHEMBL5028 | O14672 | ADAM10 | 80.33% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586681 |
| LOTUS | LTS0201635 |
| wikiData | Q77512076 |