[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2S,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)oxan-2-yl] hydrogen phosphate
Internal ID | 64725b08-9921-4ccb-8c56-8469d72af2fa |
Taxonomy | Nucleosides, nucleotides, and analogues > Pyrimidine nucleotides > Pyrimidine ribonucleotides > Pyrimidine ribonucleoside diphosphates |
IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2S,3S,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
SMILES (Canonical) | C1C(C(C(C(O1)(CO)OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H]([C@@H]([C@](O1)(CO)OP(=O)(O)OP(=O)(O)OC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=CC(=O)NC3=O)O)O)O)O)O |
InChI | InChI=1S/C15H24N2O17P2/c18-5-15(12(24)9(21)6(19)3-30-15)33-36(28,29)34-35(26,27)31-4-7-10(22)11(23)13(32-7)17-2-1-8(20)16-14(17)25/h1-2,6-7,9-13,18-19,21-24H,3-5H2,(H,26,27)(H,28,29)(H,16,20,25)/t6-,7+,9+,10+,11+,12-,13+,15-/m0/s1 |
InChI Key | XFMLHGCQNDDNPW-OPARKVNLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24N2O17P2 |
Molecular Weight | 566.30 g/mol |
Exact Mass | 566.05502130 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | -6.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.77% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.90% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.82% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.95% | 91.11% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.50% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.08% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.89% | 97.25% |
CHEMBL2123 | P51582 | Pyrimidinergic receptor P2Y4 | 88.11% | 93.39% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 86.81% | 80.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.74% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.06% | 89.00% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 85.23% | 97.78% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.05% | 95.83% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 84.34% | 98.59% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.33% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.09% | 93.04% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.05% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.70% | 99.23% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.70% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.58% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.57% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.83% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.05% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helianthus tuberosus |
PubChem | 163195606 |
LOTUS | LTS0216253 |
wikiData | Q105327106 |