[(10R,11S,13S,14R,15R)-3,4,5,14,20,21,22-heptahydroxy-8,17-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl]methyl 3,4,5-trihydroxybenzoate
Internal ID | 34344aeb-8720-466c-8b15-7ba2554f6790 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(10R,11S,13S,14R,15R)-3,4,5,14,20,21,22-heptahydroxy-8,17-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OC[C@H]2[C@H]([C@@H]3[C@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)O |
InChI | InChI=1S/C34H26O22/c35-12-1-8(2-13(36)21(12)41)30(48)52-7-18-25(45)28-29(34(53-18)56-31(49)9-3-14(37)22(42)15(38)4-9)55-33(51)11-6-17(40)24(44)27(47)20(11)19-10(32(50)54-28)5-16(39)23(43)26(19)46/h1-6,18,25,28-29,34-47H,7H2/t18-,25+,28+,29+,34-/m0/s1 |
InChI Key | WKPZPHSGAOCQCK-UFOJWMNOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H26O22 |
Molecular Weight | 786.60 g/mol |
Exact Mass | 786.09157245 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
![2D Structure of [(10R,11S,13S,14R,15R)-3,4,5,14,20,21,22-heptahydroxy-8,17-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl]methyl 3,4,5-trihydroxybenzoate 2D Structure of [(10R,11S,13S,14R,15R)-3,4,5,14,20,21,22-heptahydroxy-8,17-dioxo-11-(3,4,5-trihydroxybenzoyl)oxy-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl]methyl 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/603113a0-8579-11ee-afec-59e08009a692.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.54% | 95.64% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.83% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.53% | 83.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.86% | 95.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.54% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.53% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.73% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.54% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.21% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 87.96% | 98.95% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.70% | 89.34% |
CHEMBL3194 | P02766 | Transthyretin | 87.11% | 90.71% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.60% | 97.21% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.11% | 99.23% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.04% | 92.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.79% | 92.62% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.58% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.29% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.16% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.97% | 96.95% |
CHEMBL2535 | P11166 | Glucose transporter | 80.06% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Monochaetum multiflorum |
PubChem | 163022894 |
LOTUS | LTS0133888 |
wikiData | Q105307596 |