[(1S,2S,3S,4S)-1,4-diacetyloxy-5-cyano-7-hydroxy-3-methyl-6,11-dioxo-1,2,3,4-tetrahydrobenzo[b]carbazol-2-yl] acetate
| Internal ID | 7df66491-a99c-450e-af57-3e3e9ac15040 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | [(1S,2S,3S,4S)-1,4-diacetyloxy-5-cyano-7-hydroxy-3-methyl-6,11-dioxo-1,2,3,4-tetrahydrobenzo[b]carbazol-2-yl] acetate |
| SMILES (Canonical) | CC1C(C(C2=C(C1OC(=O)C)N(C3=C2C(=O)C4=C(C3=O)C(=CC=C4)O)C#N)OC(=O)C)OC(=O)C |
| SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H](C2=C([C@H]1OC(=O)C)N(C3=C2C(=O)C4=C(C3=O)C(=CC=C4)O)C#N)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C24H20N2O9/c1-9-22(33-10(2)27)19-17(24(35-12(4)29)23(9)34-11(3)28)16-18(26(19)8-25)21(32)15-13(20(16)31)6-5-7-14(15)30/h5-7,9,22-24,30H,1-4H3/t9-,22-,23-,24-/m0/s1 |
| InChI Key | CLWRIZLHGISADS-VBJSWAQPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H20N2O9 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.11688022 g/mol |
| Topological Polar Surface Area (TPSA) | 162.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.52% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.23% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 96.22% | 96.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.70% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.28% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.54% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.09% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.24% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.81% | 86.33% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.42% | 82.69% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.32% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.13% | 91.19% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.90% | 86.92% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.85% | 99.15% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.35% | 97.21% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.53% | 96.67% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 82.15% | 97.53% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.91% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589271 |
| LOTUS | LTS0127626 |
| wikiData | Q104964051 |