(1S,4S,5S,8R,9S,10R,11S,13S,14R,17R,18S,22R)-10,11,22-trihydroxy-5,9,13,20,20-pentamethyl-23-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-9-carboxylic acid
Internal ID | 2eb86164-76bc-4074-ab1c-24fa856069d5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,4S,5S,8R,9S,10R,11S,13S,14R,17R,18S,22R)-10,11,22-trihydroxy-5,9,13,20,20-pentamethyl-23-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-9-carboxylic acid |
SMILES (Canonical) | CC1(CC2C34CCC5C(C3CCC2(C(C1)O)C(=O)O4)(CCC6C5(CC(C(C6(C)C(=O)O)O)O)C)C)C |
SMILES (Isomeric) | C[C@]12CC[C@@H]3[C@]([C@H]1CC[C@@]45[C@H]2CC[C@@]6([C@@H]4CC(C[C@H]6O)(C)C)C(=O)O5)(C[C@@H]([C@@H]([C@@]3(C)C(=O)O)O)O)C |
InChI | InChI=1S/C29H44O7/c1-24(2)13-19-28(20(31)14-24)10-7-18-25(3)9-6-17-26(4,12-15(30)21(32)27(17,5)22(33)34)16(25)8-11-29(18,19)36-23(28)35/h15-21,30-32H,6-14H2,1-5H3,(H,33,34)/t15-,16-,17+,18-,19-,20+,21-,25-,26-,27-,28-,29+/m0/s1 |
InChI Key | VDUTWZBXKDNVIK-XXFQTEAJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H44O7 |
Molecular Weight | 504.70 g/mol |
Exact Mass | 504.30870374 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 4.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.72% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.13% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.55% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.10% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.92% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.82% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 85.25% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.48% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.89% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.86% | 91.19% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.81% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.61% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.25% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.03% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Atroxima afzeliana |
PubChem | 162915684 |
LOTUS | LTS0239592 |
wikiData | Q104665135 |