D-Fructose, 6-(dihydrogen phosphate)
| Internal ID | d0de5ae6-ed9c-4f80-af08-faf6eeb01553 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Monosaccharides > Pentoses > Pentose phosphates |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES (Canonical) | C(C1C(C(C(O1)(CO)O)O)O)OP(=O)(O)O |
| SMILES (Isomeric) | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O)OP(=O)(O)O |
| InChI | InChI=1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6-/m1/s1 |
| InChI Key | BGWGXPAPYGQALX-ARQDHWQXSA-N |
| Popularity | 132 references in papers |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 260.02971899 g/mol |
| Topological Polar Surface Area (TPSA) | 157.00 Ų |
| XlogP | -3.90 |
| beta-D-fructofuranose 6-phosphate |
| 6-O-phosphono-beta-D-fructofuranose |
| 113181-03-6 |
| CHEBI:16084 |
| [(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl dihydrogen phosphate |
| (1R,4S)-(S)-Bicalutamide Sulfide Camphanic Acid Ester |
| F6P |
| 1mto |
| SCHEMBL8056 |
| CHEMBL604196 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 94.15% | 94.01% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.24% | 91.11% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.14% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.76% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.90% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 85.81% | 95.93% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.05% | 96.61% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 83.31% | 97.78% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.02% | 86.92% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.87% | 80.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.25% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 440641 |
| LOTUS | LTS0241410 |
| wikiData | Q27098371 |