6-O-Acetylmexicanin I
Internal ID | beb1ee6d-17a3-40a4-bade-4f524428762b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones |
IUPAC Name | (5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) acetate |
SMILES (Canonical) | CC1CC2C(C(C3(C1C=CC3=O)C)OC(=O)C)C(=C)C(=O)O2 |
SMILES (Isomeric) | CC1CC2C(C(C3(C1C=CC3=O)C)OC(=O)C)C(=C)C(=O)O2 |
InChI | InChI=1S/C17H20O5/c1-8-7-12-14(9(2)16(20)22-12)15(21-10(3)18)17(4)11(8)5-6-13(17)19/h5-6,8,11-12,14-15H,2,7H2,1,3-4H3 |
InChI Key | DCNRYQODUSSOKC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H20O5 |
Molecular Weight | 304.34 g/mol |
Exact Mass | 304.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 69.70 Ų |
XlogP | 2.00 |
(3aR)-2,3,3a,4,4a,5,7aalpha,8,9,9aalpha-Decahydro-4abeta,8alpha-dimethyl-3-methylene-4beta-acetoxyazuleno[6,5-b]furan-2,5-dione |
6895-47-2 |
4a,8-dimethyl-3-methylidene-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl acetate |
DTXSID20975281 |
BCP34451 |
NSC153859 |
NSC166124 |
NSC-153859 |
NSC-166124 |
Azuleno[6,5-dione, 4-(acetyloxy)-3,3a,4,4a,7a,8,9,9a-octahydro-4a,8-dimethyl-3-methylene-, [3aR-(3a.alpha.,4.alpha.,4a.beta.,7a.alpha.,8.alpha.,9a.alpha.)]- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
631 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.40% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.78% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.94% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.88% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.87% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.55% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.34% | 96.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.83% | 97.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.15% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.36% | 90.17% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.05% | 94.80% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.58% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 81.05% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.02% | 91.07% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.01% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.30% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.05% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arnica longifolia |
Dittrichia graveolens |
Helenium aromaticum |
Helenium bigelovii |
Helenium donianum |
Helenium radiatum |
Hymenoxys integrifolia |
PubChem | 98952 |
LOTUS | LTS0217849 |
wikiData | Q104975673 |