6-Methyl-2-[2-(5-methyl-2-oxochromen-4-yl)oxyethylidene]-5-oxohept-6-enal
| Internal ID | b5e9f6ac-60cd-4952-b85a-0fed3f0a839a |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 6-methyl-2-[2-(5-methyl-2-oxochromen-4-yl)oxyethylidene]-5-oxohept-6-enal |
| SMILES (Canonical) | CC1=C2C(=CC=C1)OC(=O)C=C2OCC=C(CCC(=O)C(=C)C)C=O |
| SMILES (Isomeric) | CC1=C2C(=CC=C1)OC(=O)C=C2OCC=C(CCC(=O)C(=C)C)C=O |
| InChI | InChI=1S/C20H20O5/c1-13(2)16(22)8-7-15(12-21)9-10-24-18-11-19(23)25-17-6-4-5-14(3)20(17)18/h4-6,9,11-12H,1,7-8,10H2,2-3H3 |
| InChI Key | IXOGBQKENCHXCF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 69.70 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.31% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.30% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.24% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.19% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.70% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.45% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.05% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.83% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.39% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.34% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.48% | 99.23% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.01% | 97.21% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.47% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.00% | 96.95% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.04% | 94.80% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.02% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mutisia orbignyana |
| PubChem | 163023705 |
| LOTUS | LTS0060544 |
| wikiData | Q105122323 |